What is the structure of 1/3-Dibromobenzene?
Identification of 1,3-DIBROMOBENZENE Chemical Compound
| Chemical Formula | C6H4Br2 |
|---|---|
| IUPAC Name | 1,3-dibromobenzene |
| SMILES String | Brc1cccc(Br)c1 |
| InChI | InChI=1S/C6H4Br2/c7-5-2-1-3-6(8)4-5/h1-4H |
| InChIKey | JSRLURSZEMLAFO-UHFFFAOYSA-N |
What is the common name of 1/3-Dibromobenzene?
1,3-Dibromobenzene
| PubChem CID | 7927 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C6H4Br2 |
| Synonyms | 1,3-DIBROMOBENZENE 108-36-1 m-Dibromobenzene Benzene, 1,3-dibromo- Benzene, m-dibromo- More… |
What is the Iupac name of M-Dibromobenzene?
m-Dibromobenzene – Names and Identifiers
| Name | 1,3-Dibromobenzene |
|---|---|
| Synonyms | m-Dibromobenzene O,O-diethyl O-(5-methyl-1H-pyrazol-3-yl) phosphorothioate |
| CAS | 108-36-1 |
| EINECS | 203-574-2 |
| InChI | InChI=1/C6H4Br2/c7-5-2-1-3-6(8)4-5/h1-4H |
What is the melting point of P Dibromobenzene?
86°C to 90°C
Specifications
| Density | 1.841 |
|---|---|
| Melting Point | 86°C to 90°C |
| Odor | Characteristic |
| Flash Point | >100°C (212°F) |
| Quantity | 50g |
How many isomeric dibromobenzene exist?
It is one of three isomers, the others being 1,3- and 1,4-dibromobenzene. It is a colorless liquid, although impure samples appear yellowish….1,2-Dibromobenzene.
| Names | |
|---|---|
| ChemSpider | 13875212 |
| ECHA InfoCard | 100.008.645 |
| EC Number | 209-507-3 |
| Gmelin Reference | 130950 |
How many isomers does dibromobenzene have?
three isomers
2. Converting benzene to dibromobenzene gives three isomers.
What is the dipole moment of 1/3-dichlorobenzene?
2.503920 Debye
The calculated dipole moment for 1,3-Dichlorobenzene was found to be 2.503920 Debye.
What is the boiling point of 1/3-dichlorobenzene?
173 °C
1,3-Dichlorobenzene/Boiling point
1,3-Dichlorobenzene is a colourless, flammable liquid with a characteristic aromatic odour (molar mass 147.0 g/mol, melting point −24.7°C, boiling point 173°C).
How many isomers does 1/2-Dibromobenzene have?
1,2-Dibromobenzene is an organobromine compound with the formula C6H4Br2. It is one of three isomers, the others being 1,3- and 1,4-dibromobenzene. It is a colorless liquid, although impure samples appear yellowish. The compound is a precursor to many 1,2-disubstituted derivatives of benzene.
How to calculate InChI for 1, 4 dibromobenzene?
1,4-dibromobenzene is a dibromobenzene. Computed by LexiChem 2.6.6 (PubChem release 2019.06.18) InChI=1S/C6H4Br2/c7-5-1-2-6 (8)4-3-5/h1-4H Computed by InChI 1.0.5 (PubChem release 2019.06.18)
Which is the correct formula for dibromobenzene 1, 2?
Molecular Formula. C6H4Br2. Synonyms. 1,2-DIBROMOBENZENE. 583-53-9. o-Dibromobenzene. DIBROMOBENZENE. Benzene, 1,2-dibromo-. More…
What is the smell of 1, 4 dibromobenzene?
1,4-Dibromobenzene ( p -dibromobenzene) is an organic compound that is solid at room temperature. This compound has two bromine atoms (bromo substituents) off the central benzene ring. It has a strong smell similar to that of the lighter chlorine analogue.
What is the Koc of p-dibromobenzene?
The Koc of p-dibromobenzene is estimated as approximately 2,700(SRC), using an experimental log Kow of 3.79(1,SRC) and a regression-derived equation(2,SRC). According to a recommended classification scheme(3), this estimated Koc value suggests that p-dibromobenzene has slight mobility in soil(SRC).